C18H27FN2O4 — CID 154905412
N-[(4-fluoro-2-methoxyphenyl)methyl]-4-pyrrolidin-1-ylpentanamide;formic acid (PubChem CID 154905412) has the molecular formula C18H27FN2O4 and a molecular weight of 354.42 g/mol. Its IUPAC name is N-[(4-fluoro-2-methoxyphenyl)methyl]-4-pyrrolidin-1-ylpentanamide;formic acid.
| Compound Name | N-[(4-fluoro-2-methoxyphenyl)methyl]-4-pyrrolidin-1-ylpentanamide;formic acid |
|---|---|
| PubChem CID | 154905412 |
| Molecular Formula | C18H27FN2O4 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | N-[(4-fluoro-2-methoxyphenyl)methyl]-4-pyrrolidin-1-ylpentanamide;formic acid |
| SMILES | COc1cc(F)ccc1CNC(=O)CCC(C)N1CCCC1.O=CO |
| InChI | InChI=1S/C17H25FN2O2.CH2O2/c1-13(20-9-3-4-10-20)5-8-17(21)19-12-14-6-7-15(18)11-16(14)22-2;2-1-3/h6-7,11,13H,3-5,8-10,12H2,1-2H3,(H,19,21);1H,(H,2,3) |
| InChIKey | VFXJLXMUKHEUTR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|