About formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide
formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide (PubChem CID 154905765) has the molecular formula C17H27N3O5
and a molecular weight of 353.42 g/mol. Its IUPAC name is formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide |
| PubChem CID | 154905765 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide |
| SMILES | CNC(=O)c1ccc(CNC(=O)CCC(C)N2CCCC2)o1.O=CO |
| InChI | InChI=1S/C16H25N3O3.CH2O2/c1-12(19-9-3-4-10-19)5-8-15(20)18-11-13-6-7-14(22-13)16(21)17-2;2-1-3/h6-7,12H,3-5,8-11H2,1-2H3,(H,17,21)(H,18,20);1H,(H,2,3) |
| InChIKey | AYJDXXHRWLZZNT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide?
The IUPAC name of formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide (CID 154905765) is formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide.
What is the SMILES notation for formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide?
The canonical SMILES for formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide is CNC(=O)c1ccc(CNC(=O)CCC(C)N2CCCC2)o1.O=CO.
What is the InChIKey of formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide?
The InChIKey is AYJDXXHRWLZZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O3.CH2O2/c1-12(19-9-3-4-10-19)5-8-15(20)18-11-13-6-7-14(22-13)16(21)17-2;2-1-3/h6-7,12H,3-5,8-11H2,1-2H3,(H,17,21)(H,18,20);1H,(H,2,3).
What are the key properties of formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide?
formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide has a molecular weight of 353.42 g/mol, XLogP of 1.22, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;N-methyl-5-[(4-pyrrolidin-1-ylpentanoylamino)methyl]furan-2-carboxamide is sourced from PubChem (CID 154905765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).