C12H19Cl2F3N4 — CID 154906188
1-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-3-amine;dihydrochloride (PubChem CID 154906188) has the molecular formula C12H19Cl2F3N4 and a molecular weight of 347.21 g/mol. Its IUPAC name is 1-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-3-amine;dihydrochloride.
| Compound Name | 1-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 154906188 |
| Molecular Formula | C12H19Cl2F3N4 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]piperidin-3-amine;dihydrochloride |
| SMILES | Cc1nc(C(F)(F)F)ncc1CN1CCCC(N)C1.Cl.Cl |
| InChI | InChI=1S/C12H17F3N4.2ClH/c1-8-9(5-17-11(18-8)12(13,14)15)6-19-4-2-3-10(16)7-19;;/h5,10H,2-4,6-7,16H2,1H3;2*1H |
| InChIKey | NIKGWTRJGRSLFE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |