C15H31Cl2N3O — CID 154906371
4-[3-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-2,2-dimethylpropyl]morpholine;dihydrochloride (PubChem CID 154906371) has the molecular formula C15H31Cl2N3O and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-[3-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-2,2-dimethylpropyl]morpholine;dihydrochloride.
| Compound Name | 4-[3-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-2,2-dimethylpropyl]morpholine;dihydrochloride |
|---|---|
| PubChem CID | 154906371 |
| Molecular Formula | C15H31Cl2N3O |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[3-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-2,2-dimethylpropyl]morpholine;dihydrochloride |
| SMILES | CC(C)(CN1CCOCC1)CN1C[C@@H]2CCN[C@@H]2C1.Cl.Cl |
| InChI | InChI=1S/C15H29N3O.2ClH/c1-15(2,11-17-5-7-19-8-6-17)12-18-9-13-3-4-16-14(13)10-18;;/h13-14,16H,3-12H2,1-2H3;2*1H/t13-,14+;;/m0../s1 |
| InChIKey | XCMFJEIROVWXHR-WICJZZOFSA-N |
| XLogP | 1.48 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |