C15H22F3N5O3 — CID 154906788
(1R,9aR)-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide;formic acid (PubChem CID 154906788) has the molecular formula C15H22F3N5O3 and a molecular weight of 377.37 g/mol. Its IUPAC name is (1R,9aR)-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide;formic acid.
| Compound Name | (1R,9aR)-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154906788 |
| Molecular Formula | C15H22F3N5O3 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (1R,9aR)-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide;formic acid |
| SMILES | O=C(NCc1nc(C(F)(F)F)n[nH]1)[C@@H]1CCCN2CCCC[C@H]12.O=CO |
| InChI | InChI=1S/C14H20F3N5O.CH2O2/c15-14(16,17)13-19-11(20-21-13)8-18-12(23)9-4-3-7-22-6-2-1-5-10(9)22;2-1-3/h9-10H,1-8H2,(H,18,23)(H,19,20,21);1H,(H,2,3)/t9-,10-;/m1./s1 |
| InChIKey | GRRYQKONDZPAIG-DHTOPLTISA-N |
| XLogP | 1.40 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|