C15H26N6O4 — CID 154905677
N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid (PubChem CID 154905677) has the molecular formula C15H26N6O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid.
| Compound Name | N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154905677 |
| Molecular Formula | C15H26N6O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid |
| SMILES | Nc1n[nH]c(CNC(=O)C2CCN(C3CCOCC3)CC2)n1.O=CO |
| InChI | InChI=1S/C14H24N6O2.CH2O2/c15-14-17-12(18-19-14)9-16-13(21)10-1-5-20(6-2-10)11-3-7-22-8-4-11;2-1-3/h10-11H,1-9H2,(H,16,21)(H3,15,17,18,19);1H,(H,2,3) |
| InChIKey | SLHBSQIQHAVDMU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|