C16H26N4O4S — CID 154909808
N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid (PubChem CID 154909808) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid.
| Compound Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154909808 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(oxan-4-yl)piperidine-4-carboxamide;formic acid |
| SMILES | Nc1nc(CNC(=O)C2CCN(C3CCOCC3)CC2)cs1.O=CO |
| InChI | InChI=1S/C15H24N4O2S.CH2O2/c16-15-18-12(10-22-15)9-17-14(20)11-1-5-19(6-2-11)13-3-7-21-8-4-13;2-1-3/h10-11,13H,1-9H2,(H2,16,18)(H,17,20);1H,(H,2,3) |
| InChIKey | ANAAVEPOUDUHJT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|