C24H40N4O5 — CID 154907167
N-[2-(azepan-1-yl)-2-phenylethyl]-2-(4-methyl-1,4-diazepan-1-yl)acetamide;formic acid (PubChem CID 154907167) has the molecular formula C24H40N4O5 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-phenylethyl]-2-(4-methyl-1,4-diazepan-1-yl)acetamide;formic acid.
| Compound Name | N-[2-(azepan-1-yl)-2-phenylethyl]-2-(4-methyl-1,4-diazepan-1-yl)acetamide;formic acid |
|---|---|
| PubChem CID | 154907167 |
| Molecular Formula | C24H40N4O5 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-phenylethyl]-2-(4-methyl-1,4-diazepan-1-yl)acetamide;formic acid |
| SMILES | CN1CCCN(CC(=O)NCC(c2ccccc2)N2CCCCCC2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C22H36N4O.2CH2O2/c1-24-12-9-13-25(17-16-24)19-22(27)23-18-21(20-10-5-4-6-11-20)26-14-7-2-3-8-15-26;2*2-1-3/h4-6,10-11,21H,2-3,7-9,12-19H2,1H3,(H,23,27);2*1H,(H,2,3) |
| InChIKey | DJIPCFSIYXGBLB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|