C20H30N4O3 — CID 154907320
1-(2,3-dimethylphenyl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]piperidin-4-amine;formic acid (PubChem CID 154907320) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]piperidin-4-amine;formic acid.
| Compound Name | 1-(2,3-dimethylphenyl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]piperidin-4-amine;formic acid |
|---|---|
| PubChem CID | 154907320 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]piperidin-4-amine;formic acid |
| SMILES | CCc1nc(CCNC2CCN(c3cccc(C)c3C)CC2)no1.O=CO |
| InChI | InChI=1S/C19H28N4O.CH2O2/c1-4-19-21-18(22-24-19)8-11-20-16-9-12-23(13-10-16)17-7-5-6-14(2)15(17)3;2-1-3/h5-7,16,20H,4,8-13H2,1-3H3;1H,(H,2,3) |
| InChIKey | KZDHRMGTYKPHKM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|