C17H32N2O3S — CID 154909119
N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]-3-methylsulfanylpropanamide;formic acid (PubChem CID 154909119) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]-3-methylsulfanylpropanamide;formic acid.
| Compound Name | N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]-3-methylsulfanylpropanamide;formic acid |
|---|---|
| PubChem CID | 154909119 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]-3-methylsulfanylpropanamide;formic acid |
| SMILES | CSCCC(=O)NCCC1CCCCN1C1CCCC1.O=CO |
| InChI | InChI=1S/C16H30N2OS.CH2O2/c1-20-13-10-16(19)17-11-9-15-8-4-5-12-18(15)14-6-2-3-7-14;2-1-3/h14-15H,2-13H2,1H3,(H,17,19);1H,(H,2,3) |
| InChIKey | QJBKXMQPDAKLOM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|