C13H26N2O4S — CID 154910365
formic acid;N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylpropanamide (PubChem CID 154910365) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is formic acid;N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylpropanamide.
| Compound Name | formic acid;N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 154910365 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | formic acid;N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylpropanamide |
| SMILES | CSCCC(=O)NCCCN1CCC(O)CC1.O=CO |
| InChI | InChI=1S/C12H24N2O2S.CH2O2/c1-17-10-5-12(16)13-6-2-7-14-8-3-11(15)4-9-14;2-1-3/h11,15H,2-10H2,1H3,(H,13,16);1H,(H,2,3) |
| InChIKey | IJDSOGAMDYQRAO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|