C15H28N4O5S — CID 154909299
formic acid;4-methoxy-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidine-1-sulfonamide (PubChem CID 154909299) has the molecular formula C15H28N4O5S and a molecular weight of 376.48 g/mol. Its IUPAC name is formic acid;4-methoxy-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidine-1-sulfonamide.
| Compound Name | formic acid;4-methoxy-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 154909299 |
| Molecular Formula | C15H28N4O5S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | formic acid;4-methoxy-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidine-1-sulfonamide |
| SMILES | COC1CCN(S(=O)(=O)NC(c2nccn2C)C(C)C)CC1.O=CO |
| InChI | InChI=1S/C14H26N4O3S.CH2O2/c1-11(2)13(14-15-7-10-17(14)3)16-22(19,20)18-8-5-12(21-4)6-9-18;2-1-3/h7,10-13,16H,5-6,8-9H2,1-4H3;1H,(H,2,3) |
| InChIKey | ZEMGGWPREWTVIA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|