C16H20F3N3O2S — CID 154909430
formic acid;N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]thian-3-amine (PubChem CID 154909430) has the molecular formula C16H20F3N3O2S and a molecular weight of 375.42 g/mol. Its IUPAC name is formic acid;N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]thian-3-amine.
| Compound Name | formic acid;N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]thian-3-amine |
|---|---|
| PubChem CID | 154909430 |
| Molecular Formula | C16H20F3N3O2S |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | formic acid;N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]thian-3-amine |
| SMILES | Cn1c(CNC2CCCSC2)nc2cc(C(F)(F)F)ccc21.O=CO |
| InChI | InChI=1S/C15H18F3N3S.CH2O2/c1-21-13-5-4-10(15(16,17)18)7-12(13)20-14(21)8-19-11-3-2-6-22-9-11;2-1-3/h4-5,7,11,19H,2-3,6,8-9H2,1H3;1H,(H,2,3) |
| InChIKey | BPYBHBRGRJDUNI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|