C17H32N2O4 — CID 154909466
formic acid;2-methoxy-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]butanamide (PubChem CID 154909466) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is formic acid;2-methoxy-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]butanamide.
| Compound Name | formic acid;2-methoxy-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]butanamide |
|---|---|
| PubChem CID | 154909466 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | formic acid;2-methoxy-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]butanamide |
| SMILES | CCC(OC)C(=O)NCC1(N2CCCC2)CCCCC1.O=CO |
| InChI | InChI=1S/C16H30N2O2.CH2O2/c1-3-14(20-2)15(19)17-13-16(9-5-4-6-10-16)18-11-7-8-12-18;2-1-3/h14H,3-13H2,1-2H3,(H,17,19);1H,(H,2,3) |
| InChIKey | ILXJZJFTIONWPB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|