C15H29N3O3 — CID 120983514
2-amino-3-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (PubChem CID 120983514) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
| Compound Name | 2-amino-3-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 120983514 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 2-amino-3-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| SMILES | COCC(N)C(=O)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C15H29N3O3/c1-20-11-13(16)14(19)17-12-15(5-3-2-4-6-15)18-7-9-21-10-8-18/h13H,2-12,16H2,1H3,(H,17,19) |
| InChIKey | JDRHCYRCYSAVQM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |