C17H33N3OS — CID 119887110
(2S)-2-amino-4-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]pentanamide (PubChem CID 119887110) has the molecular formula C17H33N3OS and a molecular weight of 327.54 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]pentanamide |
|---|---|
| PubChem CID | 119887110 |
| Molecular Formula | C17H33N3OS |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NCC1(N2CCSCC2)CCCCC1 |
| InChI | InChI=1S/C17H33N3OS/c1-14(2)12-15(18)16(21)19-13-17(6-4-3-5-7-17)20-8-10-22-11-9-20/h14-15H,3-13,18H2,1-2H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | QQIQTMACYQOENV-HNNXBMFYSA-N |
| XLogP | 2.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |