C16H26Cl2N2OS — CID 99807217
(1R)-2,2-dichloro-1-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]cyclopropane-1-carboxamide (PubChem CID 99807217) has the molecular formula C16H26Cl2N2OS and a molecular weight of 365.37 g/mol. Its IUPAC name is (1R)-2,2-dichloro-1-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-1-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 99807217 |
| Molecular Formula | C16H26Cl2N2OS |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (1R)-2,2-dichloro-1-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]cyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)NCC2(N3CCSCC3)CCCCC2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H26Cl2N2OS/c1-14(11-16(14,17)18)13(21)19-12-15(5-3-2-4-6-15)20-7-9-22-10-8-20/h2-12H2,1H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | MXNVWYUXUDUFCY-CQSZACIVSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|