C18H32N2O2S — CID 122031288
4-[(1-thiomorpholin-4-ylcyclohexyl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 122031288) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is 4-[(1-thiomorpholin-4-ylcyclohexyl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-thiomorpholin-4-ylcyclohexyl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122031288 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4-[(1-thiomorpholin-4-ylcyclohexyl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCC2(N3CCSCC3)CCCCC2)CC1 |
| InChI | InChI=1S/C18H32N2O2S/c21-17(22)15-4-6-16(7-5-15)19-14-18(8-2-1-3-9-18)20-10-12-23-13-11-20/h15-16,19H,1-14H2,(H,21,22) |
| InChIKey | CJNLVFXJXUDZKV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |