C21H32N2O4 — CID 34948785
(2S)-2-(2-methoxyphenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (PubChem CID 34948785) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is (2S)-2-(2-methoxyphenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
| Compound Name | (2S)-2-(2-methoxyphenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 34948785 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (2S)-2-(2-methoxyphenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| SMILES | COc1ccccc1O[C@@H](C)C(=O)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H32N2O4/c1-17(27-19-9-5-4-8-18(19)25-2)20(24)22-16-21(10-6-3-7-11-21)23-12-14-26-15-13-23/h4-5,8-9,17H,3,6-7,10-16H2,1-2H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | HJOVVXIYXAFBQN-KRWDZBQOSA-N |
| XLogP | 2.61 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |