C15H30N2O2 — CID 95132389
(2S)-1-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propan-2-amine (PubChem CID 95132389) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (2S)-1-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propan-2-amine.
| Compound Name | (2S)-1-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 95132389 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (2S)-1-methoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]propan-2-amine |
| SMILES | COC[C@H](C)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C15H30N2O2/c1-14(12-18-2)16-13-15(6-4-3-5-7-15)17-8-10-19-11-9-17/h14,16H,3-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | LSUSEXQABXELOZ-AWEZNQCLSA-N |
| XLogP | 1.65 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |