C23H35N5O6 — CID 154909579
formic acid;N-[1-(2-hydroxyethyl)piperidin-4-yl]-4-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxamide (PubChem CID 154909579) has the molecular formula C23H35N5O6 and a molecular weight of 477.56 g/mol. Its IUPAC name is formic acid;N-[1-(2-hydroxyethyl)piperidin-4-yl]-4-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxamide.
| Compound Name | formic acid;N-[1-(2-hydroxyethyl)piperidin-4-yl]-4-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 154909579 |
| Molecular Formula | C23H35N5O6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | formic acid;N-[1-(2-hydroxyethyl)piperidin-4-yl]-4-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxamide |
| SMILES | Cc1ccc2nc(C3CCN(C(=O)NC4CCN(CCO)CC4)CC3)[nH]c2c1.O=CO.O=CO |
| InChI | InChI=1S/C21H31N5O2.2CH2O2/c1-15-2-3-18-19(14-15)24-20(23-18)16-4-10-26(11-5-16)21(28)22-17-6-8-25(9-7-17)12-13-27;2*2-1-3/h2-3,14,16-17,27H,4-13H2,1H3,(H,22,28)(H,23,24);2*1H,(H,2,3) |
| InChIKey | IQHZDCOSQPGAAO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 159.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|