C18H25F2N3O3 — CID 154909605
N-[1-(2,4-difluorophenyl)ethyl]-3-piperidin-1-ylazetidine-1-carboxamide;formic acid (PubChem CID 154909605) has the molecular formula C18H25F2N3O3 and a molecular weight of 369.41 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-3-piperidin-1-ylazetidine-1-carboxamide;formic acid.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-3-piperidin-1-ylazetidine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154909605 |
| Molecular Formula | C18H25F2N3O3 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-3-piperidin-1-ylazetidine-1-carboxamide;formic acid |
| SMILES | CC(NC(=O)N1CC(N2CCCCC2)C1)c1ccc(F)cc1F.O=CO |
| InChI | InChI=1S/C17H23F2N3O.CH2O2/c1-12(15-6-5-13(18)9-16(15)19)20-17(23)22-10-14(11-22)21-7-3-2-4-8-21;2-1-3/h5-6,9,12,14H,2-4,7-8,10-11H2,1H3,(H,20,23);1H,(H,2,3) |
| InChIKey | WBLDFRMCHMAOJY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|