C22H24F2N2O2 — CID 55622815
N-[1-(2,4-difluorophenyl)ethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide (PubChem CID 55622815) has the molecular formula C22H24F2N2O2 and a molecular weight of 386.44 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55622815 |
| Molecular Formula | C22H24F2N2O2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)NC(C)c3ccc(F)cc3F)C2)cc1 |
| InChI | InChI=1S/C22H24F2N2O2/c1-14-5-7-16(8-6-14)22(28)26-11-3-4-17(13-26)21(27)25-15(2)19-10-9-18(23)12-20(19)24/h5-10,12,15,17H,3-4,11,13H2,1-2H3,(H,25,27) |
| InChIKey | DIWRZDPZIAGDIJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |