C15H24N4O2 — CID 154909792
(3aS,6aR)-5-[(2-ethylpyrimidin-5-yl)methyl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;formic acid (PubChem CID 154909792) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3aS,6aR)-5-[(2-ethylpyrimidin-5-yl)methyl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;formic acid.
| Compound Name | (3aS,6aR)-5-[(2-ethylpyrimidin-5-yl)methyl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;formic acid |
|---|---|
| PubChem CID | 154909792 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3aS,6aR)-5-[(2-ethylpyrimidin-5-yl)methyl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;formic acid |
| SMILES | CCc1ncc(CN2C[C@H]3CN(C)C[C@H]3C2)cn1.O=CO |
| InChI | InChI=1S/C14H22N4.CH2O2/c1-3-14-15-4-11(5-16-14)6-18-9-12-7-17(2)8-13(12)10-18;2-1-3/h4-5,12-13H,3,6-10H2,1-2H3;1H,(H,2,3)/t12-,13+; |
| InChIKey | VBKHMZOZIITVGK-OEEJBDNKSA-N |
| XLogP | 0.73 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|