C21H29N3O6 — CID 154910180
N-[(3S)-1-benzylpiperidin-3-yl]-2-oxo-1,3-dioxa-8-azaspiro[4.5]decane-8-carboxamide;formic acid (PubChem CID 154910180) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[(3S)-1-benzylpiperidin-3-yl]-2-oxo-1,3-dioxa-8-azaspiro[4.5]decane-8-carboxamide;formic acid.
| Compound Name | N-[(3S)-1-benzylpiperidin-3-yl]-2-oxo-1,3-dioxa-8-azaspiro[4.5]decane-8-carboxamide;formic acid |
|---|---|
| PubChem CID | 154910180 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[(3S)-1-benzylpiperidin-3-yl]-2-oxo-1,3-dioxa-8-azaspiro[4.5]decane-8-carboxamide;formic acid |
| SMILES | O=C1OCC2(CCN(C(=O)N[C@H]3CCCN(Cc4ccccc4)C3)CC2)O1.O=CO |
| InChI | InChI=1S/C20H27N3O4.CH2O2/c24-18(23-11-8-20(9-12-23)15-26-19(25)27-20)21-17-7-4-10-22(14-17)13-16-5-2-1-3-6-16;2-1-3/h1-3,5-6,17H,4,7-15H2,(H,21,24);1H,(H,2,3)/t17-;/m0./s1 |
| InChIKey | UUJFUSDAZZZWCU-LMOVPXPDSA-N |
| XLogP | 2.06 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|