C20H27N5O3 — CID 154910515
1-[(5,6-dimethyl-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[2-(1-methylpyrrol-2-yl)ethyl]urea;formic acid (PubChem CID 154910515) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-[(5,6-dimethyl-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[2-(1-methylpyrrol-2-yl)ethyl]urea;formic acid.
| Compound Name | 1-[(5,6-dimethyl-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[2-(1-methylpyrrol-2-yl)ethyl]urea;formic acid |
|---|---|
| PubChem CID | 154910515 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-[(5,6-dimethyl-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[2-(1-methylpyrrol-2-yl)ethyl]urea;formic acid |
| SMILES | Cc1cc2nc(CN(C)C(=O)NCCc3cccn3C)[nH]c2cc1C.O=CO |
| InChI | InChI=1S/C19H25N5O.CH2O2/c1-13-10-16-17(11-14(13)2)22-18(21-16)12-24(4)19(25)20-8-7-15-6-5-9-23(15)3;2-1-3/h5-6,9-11H,7-8,12H2,1-4H3,(H,20,25)(H,21,22);1H,(H,2,3) |
| InChIKey | BTGQTKNJDZBKOA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|