C15H26N4O3 — CID 154911064
N-[(3-ethylimidazol-4-yl)methyl]azocane-1-carboxamide;formic acid (PubChem CID 154911064) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(3-ethylimidazol-4-yl)methyl]azocane-1-carboxamide;formic acid.
| Compound Name | N-[(3-ethylimidazol-4-yl)methyl]azocane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154911064 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-[(3-ethylimidazol-4-yl)methyl]azocane-1-carboxamide;formic acid |
| SMILES | CCn1cncc1CNC(=O)N1CCCCCCC1.O=CO |
| InChI | InChI=1S/C14H24N4O.CH2O2/c1-2-17-12-15-10-13(17)11-16-14(19)18-8-6-4-3-5-7-9-18;2-1-3/h10,12H,2-9,11H2,1H3,(H,16,19);1H,(H,2,3) |
| InChIKey | LLQZQKGSSZBQDS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|