C17H25Cl2N3O2 — CID 154911371
2,5-dihydro-1H-pyrrol-2-yl-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 154911371) has the molecular formula C17H25Cl2N3O2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 2,5-dihydro-1H-pyrrol-2-yl-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,5-dihydro-1H-pyrrol-2-yl-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 154911371 |
| Molecular Formula | C17H25Cl2N3O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2,5-dihydro-1H-pyrrol-2-yl-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | CCOc1ccccc1N1CCN(C(=O)C2C=CCN2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H23N3O2.2ClH/c1-2-22-16-8-4-3-7-15(16)19-10-12-20(13-11-19)17(21)14-6-5-9-18-14;;/h3-8,14,18H,2,9-13H2,1H3;2*1H |
| InChIKey | LSJZZDHJLJPOIA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|