C17H23N3O — CID 125443903
[(2R)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 125443903) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is [(2R)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | [(2R)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 125443903 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | [(2R)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)[C@H]3C=CCN3)CC2)c1C |
| InChI | InChI=1S/C17H23N3O/c1-13-5-3-7-16(14(13)2)19-9-11-20(12-10-19)17(21)15-6-4-8-18-15/h3-7,15,18H,8-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | QABMGZJSRQMLSJ-OAHLLOKOSA-N |
| XLogP | 1.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|