C17H24N2OS — CID 110854393
[4-(2,3-dimethylphenyl)piperazin-1-yl]-(thiolan-2-yl)methanone (PubChem CID 110854393) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is [4-(2,3-dimethylphenyl)piperazin-1-yl]-(thiolan-2-yl)methanone.
| Compound Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-(thiolan-2-yl)methanone |
|---|---|
| PubChem CID | 110854393 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-(thiolan-2-yl)methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)C3CCCS3)CC2)c1C |
| InChI | InChI=1S/C17H24N2OS/c1-13-5-3-6-15(14(13)2)18-8-10-19(11-9-18)17(20)16-7-4-12-21-16/h3,5-6,16H,4,7-12H2,1-2H3 |
| InChIKey | SZSNJSKTIFTTCD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |