About formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid
formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid (PubChem CID 154911641) has the molecular formula C19H27N3O6
and a molecular weight of 393.44 g/mol. Its IUPAC name is formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid |
| PubChem CID | 154911641 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid |
| SMILES | CNC(=O)C1CCCN(CC(=O)NCc2cc(C(=O)O)ccc2C)C1.O=CO |
| InChI | InChI=1S/C18H25N3O4.CH2O2/c1-12-5-6-13(18(24)25)8-15(12)9-20-16(22)11-21-7-3-4-14(10-21)17(23)19-2;2-1-3/h5-6,8,14H,3-4,7,9-11H2,1-2H3,(H,19,23)(H,20,22)(H,24,25);1H,(H,2,3) |
| InChIKey | HIRXOUKUHGHCGM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid?
The IUPAC name of formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid (CID 154911641) is formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid.
What is the SMILES notation for formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid?
The canonical SMILES for formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid is CNC(=O)C1CCCN(CC(=O)NCc2cc(C(=O)O)ccc2C)C1.O=CO.
What is the InChIKey of formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid?
The InChIKey is HIRXOUKUHGHCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O4.CH2O2/c1-12-5-6-13(18(24)25)8-15(12)9-20-16(22)11-21-7-3-4-14(10-21)17(23)19-2;2-1-3/h5-6,8,14H,3-4,7,9-11H2,1-2H3,(H,19,23)(H,20,22)(H,24,25);1H,(H,2,3).
What are the key properties of formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid?
formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid has a molecular weight of 393.44 g/mol, XLogP of 0.47, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;4-methyl-3-[[[2-[3-(methylcarbamoyl)piperidin-1-yl]acetyl]amino]methyl]benzoic acid is sourced from PubChem (CID 154911641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).