C17H19Cl2N3O4 — CID 154911843
3,5-dichloro-2-methoxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzamide;formic acid (PubChem CID 154911843) has the molecular formula C17H19Cl2N3O4 and a molecular weight of 400.26 g/mol. Its IUPAC name is 3,5-dichloro-2-methoxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzamide;formic acid.
| Compound Name | 3,5-dichloro-2-methoxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzamide;formic acid |
|---|---|
| PubChem CID | 154911843 |
| Molecular Formula | C17H19Cl2N3O4 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 3,5-dichloro-2-methoxy-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzamide;formic acid |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NCCNc1ccncc1C.O=CO |
| InChI | InChI=1S/C16H17Cl2N3O2.CH2O2/c1-10-9-19-4-3-14(10)20-5-6-21-16(22)12-7-11(17)8-13(18)15(12)23-2;2-1-3/h3-4,7-9H,5-6H2,1-2H3,(H,19,20)(H,21,22);1H,(H,2,3) |
| InChIKey | OSLOTUOHRVQXCG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|