C23H32N2O6 — CID 154911849
3-[[9-(cyclopentanecarbonyl)-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl]methyl]benzoic acid;formic acid (PubChem CID 154911849) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-[[9-(cyclopentanecarbonyl)-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl]methyl]benzoic acid;formic acid.
| Compound Name | 3-[[9-(cyclopentanecarbonyl)-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl]methyl]benzoic acid;formic acid |
|---|---|
| PubChem CID | 154911849 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 3-[[9-(cyclopentanecarbonyl)-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl]methyl]benzoic acid;formic acid |
| SMILES | O=C(O)c1cccc(CN2CCOC3(CCN(C(=O)C4CCCC4)CC3)C2)c1.O=CO |
| InChI | InChI=1S/C22H30N2O4.CH2O2/c25-20(18-5-1-2-6-18)24-10-8-22(9-11-24)16-23(12-13-28-22)15-17-4-3-7-19(14-17)21(26)27;2-1-3/h3-4,7,14,18H,1-2,5-6,8-13,15-16H2,(H,26,27);1H,(H,2,3) |
| InChIKey | RPPCOBKBFCBJLT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|