C20H27N3O2 — CID 97450797
cyclopent-3-en-1-yl-[4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone (PubChem CID 97450797) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 97450797 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | cyclopent-3-en-1-yl-[4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1CCC2(CC1)CN(Cc1ccccn1)CCO2 |
| InChI | InChI=1S/C20H27N3O2/c24-19(17-5-1-2-6-17)23-11-8-20(9-12-23)16-22(13-14-25-20)15-18-7-3-4-10-21-18/h1-4,7,10,17H,5-6,8-9,11-16H2 |
| InChIKey | GQNLYYQWXMQLOV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|