C18H24N4O2 — CID 97451000
cyclopent-3-en-1-yl-(4-pyrimidin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methanone (PubChem CID 97451000) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-(4-pyrimidin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methanone.
| Compound Name | cyclopent-3-en-1-yl-(4-pyrimidin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methanone |
|---|---|
| PubChem CID | 97451000 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | cyclopent-3-en-1-yl-(4-pyrimidin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methanone |
| SMILES | O=C(C1CC=CC1)N1CCC2(CC1)CN(c1ncccn1)CCO2 |
| InChI | InChI=1S/C18H24N4O2/c23-16(15-4-1-2-5-15)21-10-6-18(7-11-21)14-22(12-13-24-18)17-19-8-3-9-20-17/h1-3,8-9,15H,4-7,10-14H2 |
| InChIKey | IKINUHCVMOFPQQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|