C23H30N4O5 — CID 154911934
2-(1,3-dihydroisoindol-2-yl)-1-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]ethanone;formic acid (PubChem CID 154911934) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-yl)-1-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]ethanone;formic acid.
| Compound Name | 2-(1,3-dihydroisoindol-2-yl)-1-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]ethanone;formic acid |
|---|---|
| PubChem CID | 154911934 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-yl)-1-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]ethanone;formic acid |
| SMILES | Cc1cnccc1N1CCCN(C(=O)CN2Cc3ccccc3C2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C21H26N4O.2CH2O2/c1-17-13-22-8-7-20(17)24-9-4-10-25(12-11-24)21(26)16-23-14-18-5-2-3-6-19(18)15-23;2*2-1-3/h2-3,5-8,13H,4,9-12,14-16H2,1H3;2*1H,(H,2,3) |
| InChIKey | OABRWORMTJELQZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|