C27H30N4O3 — CID 154915059
[3-(1,3-dihydroisoindol-2-yl)phenyl]-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 154915059) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is [3-(1,3-dihydroisoindol-2-yl)phenyl]-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | [3-(1,3-dihydroisoindol-2-yl)phenyl]-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154915059 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [3-(1,3-dihydroisoindol-2-yl)phenyl]-[4-(3-methyl-4-pyridinyl)-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | Cc1cnccc1N1CCCN(C(=O)c2cccc(N3Cc4ccccc4C3)c2)CC1.O=CO |
| InChI | InChI=1S/C26H28N4O.CH2O2/c1-20-17-27-11-10-25(20)28-12-5-13-29(15-14-28)26(31)21-8-4-9-24(16-21)30-18-22-6-2-3-7-23(22)19-30;2-1-3/h2-4,6-11,16-17H,5,12-15,18-19H2,1H3;1H,(H,2,3) |
| InChIKey | DCIRPDTVESTYFI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|