C15H21F3N2O4 — CID 154912021
formic acid;N-[[1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]furan-3-carboxamide (PubChem CID 154912021) has the molecular formula C15H21F3N2O4 and a molecular weight of 350.34 g/mol. Its IUPAC name is formic acid;N-[[1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]furan-3-carboxamide.
| Compound Name | formic acid;N-[[1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 154912021 |
| Molecular Formula | C15H21F3N2O4 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | formic acid;N-[[1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]furan-3-carboxamide |
| SMILES | O=C(NCC1CCCN(CCC(F)(F)F)C1)c1ccoc1.O=CO |
| InChI | InChI=1S/C14H19F3N2O2.CH2O2/c15-14(16,17)4-6-19-5-1-2-11(9-19)8-18-13(20)12-3-7-21-10-12;2-1-3/h3,7,10-11H,1-2,4-6,8-9H2,(H,18,20);1H,(H,2,3) |
| InChIKey | DIFRAIOHDGTQPN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|