C14H17N5O3 — CID 131912720
N-[[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methyl]furan-3-carboxamide (PubChem CID 131912720) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methyl]furan-3-carboxamide.
| Compound Name | N-[[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 131912720 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methyl]furan-3-carboxamide |
| SMILES | O=C(NCC1CCCN(C(=O)c2cn[nH]n2)C1)c1ccoc1 |
| InChI | InChI=1S/C14H17N5O3/c20-13(11-3-5-22-9-11)15-6-10-2-1-4-19(8-10)14(21)12-7-16-18-17-12/h3,5,7,9-10H,1-2,4,6,8H2,(H,15,20)(H,16,17,18) |
| InChIKey | CYDVFRPGFUZTPB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |