C19H27F2N3O4 — CID 154912364
N-[(2,6-difluoro-3-methylphenyl)methyl]-1-imidazol-1-yl-3,3-dimethylbutan-2-amine;formic acid (PubChem CID 154912364) has the molecular formula C19H27F2N3O4 and a molecular weight of 399.44 g/mol. Its IUPAC name is N-[(2,6-difluoro-3-methylphenyl)methyl]-1-imidazol-1-yl-3,3-dimethylbutan-2-amine;formic acid.
| Compound Name | N-[(2,6-difluoro-3-methylphenyl)methyl]-1-imidazol-1-yl-3,3-dimethylbutan-2-amine;formic acid |
|---|---|
| PubChem CID | 154912364 |
| Molecular Formula | C19H27F2N3O4 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[(2,6-difluoro-3-methylphenyl)methyl]-1-imidazol-1-yl-3,3-dimethylbutan-2-amine;formic acid |
| SMILES | Cc1ccc(F)c(CNC(Cn2ccnc2)C(C)(C)C)c1F.O=CO.O=CO |
| InChI | InChI=1S/C17H23F2N3.2CH2O2/c1-12-5-6-14(18)13(16(12)19)9-21-15(17(2,3)4)10-22-8-7-20-11-22;2*2-1-3/h5-8,11,15,21H,9-10H2,1-4H3;2*1H,(H,2,3) |
| InChIKey | SYZRQWOJGHSPTJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|