C20H29N3O5S — CID 154912619
N-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide;formic acid (PubChem CID 154912619) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide;formic acid.
| Compound Name | N-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154912619 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide;formic acid |
| SMILES | O=C(C1CCN(C2CCS(=O)(=O)C2)CC1)N(Cc1ccncc1)C1CC1.O=CO |
| InChI | InChI=1S/C19H27N3O3S.CH2O2/c23-19(22(17-1-2-17)13-15-3-8-20-9-4-15)16-5-10-21(11-6-16)18-7-12-26(24,25)14-18;2-1-3/h3-4,8-9,16-18H,1-2,5-7,10-14H2;1H,(H,2,3) |
| InChIKey | QLIYPOFMCWSGRZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|