C15H23N5O7S — CID 154914145
N-(4-acetamido-1,2,5-oxadiazol-3-yl)-1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxamide;formic acid (PubChem CID 154914145) has the molecular formula C15H23N5O7S and a molecular weight of 417.44 g/mol. Its IUPAC name is N-(4-acetamido-1,2,5-oxadiazol-3-yl)-1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxamide;formic acid.
| Compound Name | N-(4-acetamido-1,2,5-oxadiazol-3-yl)-1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154914145 |
| Molecular Formula | C15H23N5O7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-(4-acetamido-1,2,5-oxadiazol-3-yl)-1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxamide;formic acid |
| SMILES | CC(=O)Nc1nonc1NC(=O)C1CCN(C2CCS(=O)(=O)C2)CC1.O=CO |
| InChI | InChI=1S/C14H21N5O5S.CH2O2/c1-9(20)15-12-13(18-24-17-12)16-14(21)10-2-5-19(6-3-10)11-4-7-25(22,23)8-11;2-1-3/h10-11H,2-8H2,1H3,(H,15,17,20)(H,16,18,21);1H,(H,2,3) |
| InChIKey | SYKOEPCXZONYIK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 171.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|