C24H31N3O5 — CID 154912824
formic acid;3-methyl-N-[[1-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]furan-2-carboxamide (PubChem CID 154912824) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is formic acid;3-methyl-N-[[1-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]furan-2-carboxamide.
| Compound Name | formic acid;3-methyl-N-[[1-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 154912824 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | formic acid;3-methyl-N-[[1-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCC1CCN(CC2CC(=O)N(c3ccccc3)C2)CC1.O=CO |
| InChI | InChI=1S/C23H29N3O3.CH2O2/c1-17-9-12-29-22(17)23(28)24-14-18-7-10-25(11-8-18)15-19-13-21(27)26(16-19)20-5-3-2-4-6-20;2-1-3/h2-6,9,12,18-19H,7-8,10-11,13-16H2,1H3,(H,24,28);1H,(H,2,3) |
| InChIKey | LUQCULSDOSHDDZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|