C20H30N4O6 — CID 154912028
formic acid;3-methyl-N-[[1-[2-(1-methylimidazol-2-yl)ethyl]piperidin-4-yl]methyl]furan-2-carboxamide (PubChem CID 154912028) has the molecular formula C20H30N4O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is formic acid;3-methyl-N-[[1-[2-(1-methylimidazol-2-yl)ethyl]piperidin-4-yl]methyl]furan-2-carboxamide.
| Compound Name | formic acid;3-methyl-N-[[1-[2-(1-methylimidazol-2-yl)ethyl]piperidin-4-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 154912028 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | formic acid;3-methyl-N-[[1-[2-(1-methylimidazol-2-yl)ethyl]piperidin-4-yl]methyl]furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCC1CCN(CCc2nccn2C)CC1.O=CO.O=CO |
| InChI | InChI=1S/C18H26N4O2.2CH2O2/c1-14-6-12-24-17(14)18(23)20-13-15-3-8-22(9-4-15)10-5-16-19-7-11-21(16)2;2*2-1-3/h6-7,11-12,15H,3-5,8-10,13H2,1-2H3,(H,20,23);2*1H,(H,2,3) |
| InChIKey | TWMYVURPKOKWTI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|