C17H25N3O5 — CID 154912847
N-[5-[[2-(dimethylamino)acetyl]amino]-2-methylphenyl]oxolane-3-carboxamide;formic acid (PubChem CID 154912847) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[5-[[2-(dimethylamino)acetyl]amino]-2-methylphenyl]oxolane-3-carboxamide;formic acid.
| Compound Name | N-[5-[[2-(dimethylamino)acetyl]amino]-2-methylphenyl]oxolane-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 154912847 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-[5-[[2-(dimethylamino)acetyl]amino]-2-methylphenyl]oxolane-3-carboxamide;formic acid |
| SMILES | Cc1ccc(NC(=O)CN(C)C)cc1NC(=O)C1CCOC1.O=CO |
| InChI | InChI=1S/C16H23N3O3.CH2O2/c1-11-4-5-13(17-15(20)9-19(2)3)8-14(11)18-16(21)12-6-7-22-10-12;2-1-3/h4-5,8,12H,6-7,9-10H2,1-3H3,(H,17,20)(H,18,21);1H,(H,2,3) |
| InChIKey | DFWGHGBAEBKCHW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|