C21H32N4O2 — CID 131951702
(1R,9aR)-N-[3-[[2-(dimethylamino)acetyl]amino]-4-methylphenyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide (PubChem CID 131951702) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1R,9aR)-N-[3-[[2-(dimethylamino)acetyl]amino]-4-methylphenyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide.
| Compound Name | (1R,9aR)-N-[3-[[2-(dimethylamino)acetyl]amino]-4-methylphenyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide |
|---|---|
| PubChem CID | 131951702 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (1R,9aR)-N-[3-[[2-(dimethylamino)acetyl]amino]-4-methylphenyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCN3CCCC[C@H]23)cc1NC(=O)CN(C)C |
| InChI | InChI=1S/C21H32N4O2/c1-15-9-10-16(13-18(15)23-20(26)14-24(2)3)22-21(27)17-7-6-12-25-11-5-4-8-19(17)25/h9-10,13,17,19H,4-8,11-12,14H2,1-3H3,(H,22,27)(H,23,26)/t17-,19-/m1/s1 |
| InChIKey | GLYHLFICIXQITK-IEBWSBKVSA-N |
| XLogP | 2.70 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |