C18H25N3O3 — CID 154913019
formic acid;5-(3-indol-1-ylpropylamino)azepan-2-one (PubChem CID 154913019) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is formic acid;5-(3-indol-1-ylpropylamino)azepan-2-one.
| Compound Name | formic acid;5-(3-indol-1-ylpropylamino)azepan-2-one |
|---|---|
| PubChem CID | 154913019 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | formic acid;5-(3-indol-1-ylpropylamino)azepan-2-one |
| SMILES | O=C1CCC(NCCCn2ccc3ccccc32)CCN1.O=CO |
| InChI | InChI=1S/C17H23N3O.CH2O2/c21-17-7-6-15(8-11-19-17)18-10-3-12-20-13-9-14-4-1-2-5-16(14)20;2-1-3/h1-2,4-5,9,13,15,18H,3,6-8,10-12H2,(H,19,21);1H,(H,2,3) |
| InChIKey | ABVIWXVMKMCKQK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|