C16H22N2O2S — CID 63910668
N-(3-indol-1-ylpropyl)-1,1-dioxothian-3-amine (PubChem CID 63910668) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-(3-indol-1-ylpropyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(3-indol-1-ylpropyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63910668 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(3-indol-1-ylpropyl)-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NCCCn2ccc3ccccc32)C1 |
| InChI | InChI=1S/C16H22N2O2S/c19-21(20)12-3-6-15(13-21)17-9-4-10-18-11-8-14-5-1-2-7-16(14)18/h1-2,5,7-8,11,15,17H,3-4,6,9-10,12-13H2 |
| InChIKey | HZROBOPZSHYDTH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|