C14H17ClN2O2S — CID 62563402
N-[2-(6-chloroindol-1-yl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 62563402) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is N-[2-(6-chloroindol-1-yl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[2-(6-chloroindol-1-yl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 62563402 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[2-(6-chloroindol-1-yl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCCn2ccc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C14H17ClN2O2S/c15-12-2-1-11-3-6-17(14(11)9-12)7-5-16-13-4-8-20(18,19)10-13/h1-3,6,9,13,16H,4-5,7-8,10H2 |
| InChIKey | AZAVKPYYVVFTAM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |