C11H15BrN2O3S — CID 62562815
5-bromo-1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one (PubChem CID 62562815) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is 5-bromo-1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one.
| Compound Name | 5-bromo-1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 62562815 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 5-bromo-1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one |
| SMILES | O=c1ccc(Br)cn1CCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15BrN2O3S/c12-9-1-2-11(15)14(7-9)5-4-13-10-3-6-18(16,17)8-10/h1-2,7,10,13H,3-6,8H2 |
| InChIKey | BYDCJERIMVBXGL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |